For research use only. Not for therapeutic Use.
2-Bromo-6-iodo-4-(trifluoromethyl)aniline（Cat No.:L017084）is an aromatic compound featuring both bromine and iodine atoms on the benzene ring, along with a trifluoromethyl group and an amine group. This compound is used in pharmaceutical research and organic synthesis as a key intermediate for developing complex molecules, including potential drug candidates. Its halogenated structure provides unique reactivity, particularly in cross-coupling and substitution reactions. Researchers in medicinal chemistry utilize this compound for constructing diverse molecular frameworks, aiding in the design of innovative therapeutic agents and fine chemicals.
| CAS Number | 875306-20-0 |
| Molecular Formula | C7H4BrF3IN |
| Purity | ≥95% |
| IUPAC Name | 2-bromo-6-iodo-4-(trifluoromethyl)aniline |
| InChI | InChI=1S/C7H4BrF3IN/c8-4-1-3(7(9,10)11)2-5(12)6(4)13/h1-2H,13H2 |
| InChIKey | FBHITPHKKSCFNU-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1Br)N)I)C(F)(F)F |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
