For research use only. Not for therapeutic Use.
2-Bromo-6-methoxy-4-methylpyridine is an organic compound featuring a pyridine ring with a bromine atom at the second position, a methoxy group (-OCH₃) at the sixth position, and a methyl group (-CH₃) at the fourth position. Its chemical formula is C₈H₈BrN₁O. This compound is of interest in synthetic organic chemistry and medicinal chemistry due to its potential applications in drug development and as a building block for various bioactive compounds. The presence of halogen and methoxy substituents enhances its reactivity and functional versatility.
| Catalog Number | L011741 |
| CAS Number | 1256807-52-9 |
| Molecular Formula | C7H8BrNO |
| Purity | ≥95% |
| IUPAC Name | 2-bromo-6-methoxy-4-methylpyridine |
| InChI | InChI=1S/C7H8BrNO/c1-5-3-6(8)9-7(4-5)10-2/h3-4H,1-2H3 |
| InChIKey | VLZKZEISEZUUAQ-UHFFFAOYSA-N |
| SMILES | CC1=CC(=NC(=C1)Br)OC |
