For research use only. Not for therapeutic Use.
2-Bromo-6-methoxyisonicotinic Acid(CAT: L039916) is a high-purity compound widely used in pharmaceutical and synthetic chemistry research. This brominated isonicotinic acid derivative, featuring a methoxy group, serves as a versatile intermediate for the synthesis of complex organic molecules, bioactive compounds, and pharmaceutical agents. Its unique structure supports applications in drug discovery, medicinal chemistry, and the development of novel therapeutic frameworks. With excellent stability and reactivity, 2-Bromo-6-methoxyisonicotinic Acid is an essential building block for researchers focused on innovative molecular design and advanced synthetic pathways in medicinal and chemical sciences.
CAS Number | 853029-93-3 |
Molecular Formula | C7H6BrNO3 |
Purity | ≥95% |
IUPAC Name | 2-bromo-6-methoxypyridine-4-carboxylic acid |
InChI | InChI=1S/C7H6BrNO3/c1-12-6-3-4(7(10)11)2-5(8)9-6/h2-3H,1H3,(H,10,11) |
InChIKey | MSWQBBSWODQKLQ-UHFFFAOYSA-N |
SMILES | COC1=NC(=CC(=C1)C(=O)O)Br |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |