For research use only. Not for therapeutic Use.
2-Bromo-6-methylbenzonitrile(Cat No.:L043538)is an aromatic compound featuring a bromine atom at the 2-position, a methyl group at the 6-position, and a nitrile group on the benzene ring. This compound is valuable in organic synthesis, particularly in the pharmaceutical and agrochemical industries, as it serves as a versatile intermediate for creating complex molecules. The bromine atom provides a reactive site for further functionalization, while the nitrile group adds to its reactivity. Its unique structure makes it a key building block in the development of biologically active compounds and advanced materials.
CAS Number | 77532-78-6 |
Molecular Formula | C8H6BrN |
Purity | ≥95% |
IUPAC Name | 2-bromo-6-methylbenzonitrile |
InChI | InChI=1S/C8H6BrN/c1-6-3-2-4-8(9)7(6)5-10/h2-4H,1H3 |
InChIKey | AEQBTIZIDSFIGT-UHFFFAOYSA-N |
SMILES | CC1=C(C(=CC=C1)Br)C#N |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |