For research use only. Not for therapeutic Use.
2-Bromo-6-nitropyridine(CAT: L041915) is a halogenated heterocyclic compound widely used in pharmaceutical, agrochemical, and material science research. Featuring both bromine and nitro substituents on a pyridine ring, this compound serves as a versatile intermediate for synthesizing bioactive molecules, advanced materials, and functionalized heterocycles. Its unique reactivity makes it particularly valuable in cross-coupling reactions, nucleophilic substitutions, and the development of therapeutic agents. With high purity and reliable performance, 2-Bromo-6-nitropyridine supports innovative research in medicinal chemistry, synthetic organic chemistry, and the design of complex molecular frameworks.
| Catalog Number | L041915 |
| CAS Number | 21203-78-1 |
| Molecular Formula | C5H3BrN2O2 |
| Purity | ≥95% |
| IUPAC Name | 2-bromo-6-nitropyridine |
| InChI | InChI=1S/C5H3BrN2O2/c6-4-2-1-3-5(7-4)8(9)10/h1-3H |
| InChIKey | JULQLOHNPMMKTH-UHFFFAOYSA-N |
| SMILES | C1=CC(=NC(=C1)Br)[N+](=O)[O-] |
