Home
>
Chemical Reagents>Heterocyclic Building Blocks>
>
2-Bromo-6,7-dihydro-5H-cyclopenta[b]pyridine
For research use only. Not for therapeutic Use.
2-Bromo-6,7-dihydro-5H-cyclopenta[b]pyridine(Cat No.:L048890)is a brominated heterocyclic compound used in pharmaceutical research and organic synthesis. Its unique structure, featuring a bromine atom on a cyclopenta[b]pyridine ring, makes it a valuable intermediate for creating complex molecules with potential therapeutic properties. This compound is particularly relevant in developing new drugs targeting neurological disorders and cancer. With its high reactivity and versatility, 2-Bromo-6,7-dihydro-5H-cyclopenta[b]pyridine serves as a critical building block for medicinal chemists exploring innovative drug discovery and development pathways.
Catalog Number | L048890 |
CAS Number | 1140240-18-1 |
Molecular Formula | C8H8BrN |
Purity | ≥95% |
IUPAC Name | 2-bromo-6,7-dihydro-5H-cyclopenta[b]pyridine |
InChI | InChI=1S/C8H8BrN/c9-8-5-4-6-2-1-3-7(6)10-8/h4-5H,1-3H2 |
InChIKey | UIEJOGLUJIGKKR-UHFFFAOYSA-N |
SMILES | C1CC2=C(C1)N=C(C=C2)Br |