For research use only. Not for therapeutic Use.
2-Bromo-7-chlorodibenzo[b,d]furan(CAT: L000362) is a notable compound in the field of organic chemistry and material chemistry. This chemical compound is crucial as a building block for the synthesis of organic molecules with unique structures and properties. Its dibenzo[b,d]furan core, along with the bromine and chlorine substituents, imparts distinctive reactivity that is valuable in the design and modification of organic materials. In material chemistry, this compound plays a pivotal role in the development of functional materials, including those with potential applications in electronics, optoelectronics, and organic semiconductors.
CAS Number | 2355229-03-5 |
Molecular Formula | C12H6BrClO |
Purity | ≥95% |
IUPAC Name | 2-bromo-7-chlorodibenzofuran |
InChI | InChI=1S/C12H6BrClO/c13-7-1-4-11-10(5-7)9-3-2-8(14)6-12(9)15-11/h1-6H |
InChIKey | QCGWGYFVRUSBRM-UHFFFAOYSA-N |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |