For research use only. Not for therapeutic Use.
2-Bromo-7-nitro-5H-pyrrolo[2,3-b]pyrazine is an organic compound characterized by a pyrrolo-pyrazine structure with a bromine atom at the second position and a nitro group (-NO₂) at the seventh position. Its chemical formula is C₇H₅BrN₄O₂. This compound is of interest in medicinal chemistry due to its potential biological activities, including anti-inflammatory and antitumor properties. The presence of the bromine and nitro groups enhances its reactivity, making it a valuable scaffold for the synthesis of novel therapeutic agents and research applications.
CAS Number | 1416740-16-3 |
Molecular Formula | C6H3BrN4O2 |
Purity | ≥95% |
IUPAC Name | 2-bromo-7-nitro-5H-pyrrolo[2,3-b]pyrazine |
InChI | InChI=1S/C6H3BrN4O2/c7-4-2-9-6-5(10-4)3(1-8-6)11(12)13/h1-2H,(H,8,9) |
InChIKey | VQKDSESFZOLVBL-UHFFFAOYSA-N |
SMILES | C1=C(C2=NC(=CN=C2N1)Br)[N+](=O)[O-] |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |