For research use only. Not for therapeutic Use.
2-Bromo-N-isobutylacetamide(Cat No.:L006861), is an organic compound used in chemical research and organic synthesis. Its molecular structure includes a bromine atom attached to an acetamide group with an isobutyl substituent. Chemists utilize this compound as a versatile building block in the creation of various organic derivatives and complex molecules. It finds applications in the synthesis of pharmaceuticals, agrochemicals, and specialty chemicals. The presence of the bromine atom allows for further functionalization, enabling the development of diverse organic compounds.
CAS Number | 95331-76-3 |
Molecular Formula | C6H12BrNO |
Purity | ≥95% |
IUPAC Name | 2-bromo-N-(2-methylpropyl)acetamide |
InChI | InChI=1S/C6H12BrNO/c1-5(2)4-8-6(9)3-7/h5H,3-4H2,1-2H3,(H,8,9) |
InChIKey | CYAVQYCNDWTSGQ-UHFFFAOYSA-N |
SMILES | CC(C)CNC(=O)CBr |