For research use only. Not for therapeutic Use.
2-Bromo-N-methylbenzylamine（Cat No.:L022674）is an aromatic amine compound featuring a bromine atom at the ortho position of the benzyl group and an N-methyl group. This compound is commonly used in pharmaceutical research and organic synthesis as an intermediate for the development of various biologically active molecules, including potential drug candidates. Its brominated structure provides unique reactivity, making it suitable for a range of chemical transformations, such as nucleophilic substitution and cross-coupling reactions. Researchers value this compound for creating innovative compounds in medicinal chemistry and fine chemical production.
| Catalog Number | L022674 |
| CAS Number | 698-19-1 |
| Molecular Formula | C8H10BrN |
| Purity | ≥95% |
| IUPAC Name | 1-(2-bromophenyl)-N-methylmethanamine |
| InChI | InChI=1S/C8H10BrN/c1-10-6-7-4-2-3-5-8(7)9/h2-5,10H,6H2,1H3 |
| InChIKey | TUADRPBKJHMHDH-UHFFFAOYSA-N |
| SMILES | CNCC1=CC=CC=C1Br |
