For research use only. Not for therapeutic Use.
2-Bromoacrylic acid (Cat.No:M058708) is a chemical compound used in various organic syntheses and as a reagent in biochemical research. Its bromine-containing vinyl group makes it valuable for creating diverse molecular structures. However, it should be handled with care due to its potential toxicity and reactivity.
Catalog Number | M058708 |
CAS Number | 10443-65-9 |
Molecular Formula | C3H3BrO2 |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | 2-bromoprop-2-enoic acid |
InChI | InChI=1S/C3H3BrO2/c1-2(4)3(5)6/h1H2,(H,5,6) |
InChIKey | HMENQNSSJFLQOP-UHFFFAOYSA-N |
SMILES | C=C(C(=O)O)Br |