For research use only. Not for therapeutic Use.
2-Bromoacrylic acid (Cat.No:M058708) is a chemical compound used in various organic syntheses and as a reagent in biochemical research. Its bromine-containing vinyl group makes it valuable for creating diverse molecular structures. However, it should be handled with care due to its potential toxicity and reactivity.
| CAS Number | 10443-65-9 |
| Molecular Formula | C3H3BrO2 |
| Purity | ≥95% |
| Storage | -20°C |
| IUPAC Name | 2-bromoprop-2-enoic acid |
| InChI | InChI=1S/C3H3BrO2/c1-2(4)3(5)6/h1H2,(H,5,6) |
| InChIKey | HMENQNSSJFLQOP-UHFFFAOYSA-N |
| SMILES | C=C(C(=O)O)Br |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
