For research use only. Not for therapeutic Use.
2-Bromobenzyl bromide (Cat.No:L003590) is a vital chemical compound used in organic synthesis. Its unique structure, with two bromine atoms attached to a benzene ring, makes it a versatile reagent in various chemical reactions. It is particularly employed in the preparation of pharmaceutical intermediates and agrochemicals.
CAS Number | 3433-80-5 |
Molecular Formula | C7H6Br2 |
Purity | ≥95% |
IUPAC Name | 1-bromo-2-(bromomethyl)benzene |
InChI | InChI=1S/C7H6Br2/c8-5-6-3-1-2-4-7(6)9/h1-4H,5H2 |
InChIKey | LZSYGJNFCREHMD-UHFFFAOYSA-N |
SMILES | C1=CC=C(C(=C1)CBr)Br |