For research use only. Not for therapeutic Use.
2-Bromofluorene (Cat.No:R022978) is a chemical compound with the molecular formula C13H9Br. It is a brominated derivative of fluorene, which is a polycyclic aromatic hydrocarbon. 2-Bromofluorene is commonly used in organic synthesis for the preparation of various compounds with diverse applications in pharmaceuticals, agrochemicals, and materials science.
| Catalog Number | R022978 |
| CAS Number | 1133-80-8 |
| Synonyms | 2-Bromo-9H-fluorene; NSC 1463 |
| Molecular Formula | C13H9Br |
| Purity | ≥95% |
| Storage | -20°C |
| IUPAC Name | 2-bromo-9H-fluorene |
| InChI | InChI=1S/C13H9Br/c14-11-5-6-13-10(8-11)7-9-3-1-2-4-12(9)13/h1-6,8H,7H2 |
| InChIKey | FXSCJZNMWILAJO-UHFFFAOYSA-N |
| SMILES | C1C2=CC=CC=C2C3=C1C=C(C=C3)Br |
