For research use only. Not for therapeutic Use.
2-(Bromomethyl)-4-chloropyridine hydrobromide(CAT: L000483) is a compound with significance in organic chemistry, particularly as an intermediate in the synthesis of various organic molecules. This compound serves as a valuable building block, finding applications in different fields, including pharmaceutical, agrochemical, and material chemistry.
Catalog Number | L000483 |
CAS Number | 2138157-53-4 |
Molecular Formula | C6H6Br2ClN |
Purity | ≥95% |
IUPAC Name | 2-(bromomethyl)-4-chloropyridine;hydrobromide |
InChI | InChI=1S/C6H5BrClN.BrH/c7-4-6-3-5(8)1-2-9-6;/h1-3H,4H2;1H |
InChIKey | YGQNAMIIEOOKGD-UHFFFAOYSA-N |