For research use only. Not for therapeutic Use.
2-(Bromomethyl)-5-methylpyridine hydrobromide is a brominated pyridine salt commonly used in organic synthesis and pharmaceutical research. Its structure, with a bromomethyl and methyl group on a pyridine ring, makes it a versatile intermediate in creating complex molecules. This compound is especially valuable for introducing pyridine-based frameworks into bioactive compounds, often serving as a building block in drug development and agrochemical synthesis. The hydrobromide salt form enhances its stability, supporting applications in medicinal chemistry and advanced material synthesis.
CAS Number | 2089315-69-3 |
Molecular Formula | C7H9Br2N |
Purity | ≥95% |
IUPAC Name | 2-(bromomethyl)-5-methylpyridine;hydrobromide |
InChI | InChI=1S/C7H8BrN.BrH/c1-6-2-3-7(4-8)9-5-6;/h2-3,5H,4H2,1H3;1H |
InChIKey | DGEDLGGMVQAUFH-UHFFFAOYSA-N |
SMILES | CC1=CN=C(C=C1)CBr.Br |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |