For research use only. Not for therapeutic Use.
2-(Bromomethyl)benzonitrile is an aromatic compound featuring a bromomethyl group and a nitrile functional group, making it a valuable intermediate in organic synthesis. This compound is primarily used in the preparation of various pharmaceuticals and agrochemicals. Its unique structure allows for diverse chemical transformations, including nucleophilic substitutions and cross-coupling reactions. Ongoing research focuses on its applications in the development of novel compounds with potential biological activities, highlighting its relevance in drug discovery and synthetic organic chemistry.
CAS Number | 22115-41-9 |
Synonyms | α-Bromo-o-tolunitrile; (2-Cyanophenyl)methyl Bromide; 1-(Bromomethyl)-2-cyanobenzene; 2-(Bromomethyl)benzonitrile; 2-Cyano-a-bromotoluene; 2-Cyanobenzyl Bromide; o-(Bromomethyl)benzonitrile; o-Cyanobenzyl bromide; α-Bromo-2-cyanotoluene; α-Bromo-otol |
Molecular Formula | C8H6BrN |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | 2-(bromomethyl)benzonitrile |
InChI | InChI=1S/C8H6BrN/c9-5-7-3-1-2-4-8(7)6-10/h1-4H,5H2 |
InChIKey | QGXNHCXKWFNKCG-UHFFFAOYSA-N |
SMILES | C1=CC=C(C(=C1)CBr)C#N |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |