For research use only. Not for therapeutic Use.
2-Bromonaphthalene-1-carbonitrile (Cat. No: M135906) is an organic building block that can be used as an organic chemical raw material for the preparation of pharmaceutical intermediates, mainly for scientific research.
| Catalog Number | M135906 |
| CAS Number | 138887-02-2 |
| Synonyms | 2-Bromonaphthalene-1-carbonitrile |
| Molecular Formula | C11H6BrN |
| Purity | ≥95% |
| Storage | Store at +4C |
| IUPAC Name | 2-bromonaphthalene-1-carbonitrile |
| InChI | InChI=1S/C11H6BrN/c12-11-6-5-8-3-1-2-4-9(8)10(11)7-13/h1-6H |
| InChIKey | PWQXTGXNSBDWEZ-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=CC(=C2C#N)Br |
