For research use only. Not for therapeutic Use.
2-Bromophenetole(CAT: I010071) is a chemical compound commonly used in organic synthesis and research. It is a brominated derivative of phenetole, which is an ether compound containing a phenyl group and an ethoxy group. 2-Bromophenetole can serve as a starting material or building block in various chemical reactions to create more complex molecules. Its structure and reactivity make it suitable for use in the development of pharmaceuticals, agrochemicals, and other organic compounds.
CAS Number | 583-19-7 |
Synonyms | 2-Bromophenetole; AI3-01058; AI3 01058; AI301058;2-Bromophenetole |
Molecular Formula | C8H9BrO |
Purity | ≥95% |
Solubility | Soluble in DMSO |
InChI | InChI=1S/C8H9BrO/c1-2-10-8-6-4-3-5-7(8)9/h3-6H,2H2,1H3 |
InChIKey | JVEQWIQHHWNMQX-UHFFFAOYSA-N |
SMILES | CCOC1=CC=CC=C1Br |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |