For research use only. Not for therapeutic Use.
2-Bromophenylhydrazine hydrochloride (Cat.No:R070161) is a chemical compound used in organic synthesis. It serves as a versatile building block for creating various molecules with diverse applications in pharmaceuticals and agrochemicals. Its unique structure makes it valuable in the development of specialized compounds for research and industry.
CAS Number | 50709-33-6 |
Molecular Formula | C6H8BrClN2 |
Purity | ≥95% |
Storage | RT |
IUPAC Name | (2-bromophenyl)hydrazine;hydrochloride |
InChI | InChI=1S/C6H7BrN2.ClH/c7-5-3-1-2-4-6(5)9-8;/h1-4,9H,8H2;1H |
InChIKey | PHCYUJRYSFMJMG-UHFFFAOYSA-N |
SMILES | C1=CC=C(C(=C1)NN)Br.Cl |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |