For research use only. Not for therapeutic Use.
2-Bromophenylhydrazine hydrochloride (Cat.No:R070161) is a chemical compound used in organic synthesis. It serves as a versatile building block for creating various molecules with diverse applications in pharmaceuticals and agrochemicals. Its unique structure makes it valuable in the development of specialized compounds for research and industry.
| CAS Number | 50709-33-6 |
| Molecular Formula | C6H8BrClN2 |
| Purity | ≥95% |
| Storage | RT |
| IUPAC Name | (2-bromophenyl)hydrazine;hydrochloride |
| InChI | InChI=1S/C6H7BrN2.ClH/c7-5-3-1-2-4-6(5)9-8;/h1-4,9H,8H2;1H |
| InChIKey | PHCYUJRYSFMJMG-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)NN)Br.Cl |
