For research use only. Not for therapeutic Use.
2-Bromopropane-d7 is a deuterated form of 2-bromopropane, featuring seven deuterium atoms for enhanced stability and precision in research. This isotopically labeled compound is essential for studying the pharmacokinetics, metabolism, and environmental impact of brominated hydrocarbons. 2-Bromopropane-d7 ensures reliable and consistent results in advanced chemical and toxicological research, making it a valuable tool for scientists and researchers. Ideal for use in mass spectrometry and other analytical techniques, it supports accurate tracking and quantification in various biological and environmental studies.
| Catalog Number | R039504 |
| CAS Number | 39091-63-9 |
| Synonyms | Isopropyl-d7 Bromide; Perdeuterioisopropyl Bromide; |
| Molecular Formula | C3H7Br |
| Purity | ≥95% |
| Storage | Store at +4C |
| IUPAC Name | 2-bromo-1,1,1,2,3,3,3-heptadeuteriopropane |
| InChI | InChI=1S/C3H7Br/c1-3(2)4/h3H,1-2H3/i1D3,2D3,3D |
| InChIKey | NAMYKGVDVNBCFQ-YYWVXINBSA-N |
| SMILES | CC(C)Br |
