For research use only. Not for therapeutic Use.
2-Bromoquinoline(CAT: M197969) is a halogenated quinoline derivative commonly used as an intermediate in the synthesis of complex organic compounds. The bromine atom on the quinoline ring enhances its reactivity, making it ideal for cross-coupling reactions, such as Suzuki and Heck couplings, in medicinal and materials chemistry. This compound is frequently employed in the development of pharmaceuticals, agrochemicals, and as a precursor in heterocyclic synthesis due to its aromatic structure and versatile reactivity. In drug discovery, 2-Bromoquinoline is valuable for creating molecules with potential bioactivity, particularly those targeting microbial and cancer cell pathways.
CAS Number | 2005-43-8 |
Molecular Formula | C9H6BrN |
Purity | ≥95% |
IUPAC Name | 2-bromoquinoline |
InChI | InChI=1S/C9H6BrN/c10-9-6-5-7-3-1-2-4-8(7)11-9/h1-6H |
InChIKey | QKJAZPHKNWSXDF-UHFFFAOYSA-N |
SMILES | C1=CC=C2C(=C1)C=CC(=N2)Br |