For research use only. Not for therapeutic Use.
2-Bromotetradecanoic acid(Cat No.:M066890) is a chemical compound with the molecular formula C14H27BrO2. It consists of a tetradecanoic acid molecule with a bromine atom attached to the second carbon atom in the chain. This compound is utilized in various chemical synthesis processes and research applications. Its bromine substituent makes it valuable in organic synthesis, particularly in the creation of complex molecules. Additionally, it serves as a precursor for the preparation of diverse organic compounds. Due to its structural properties, 2-bromotetradecanoic acid is also studied for its potential biological activities and pharmacological applications.
Catalog Number | M066890 |
CAS Number | 10520-81-7 |
Molecular Formula | C14H27BrO2 |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | 2-bromotetradecanoic acid |
InChI | InChI=1S/C14H27BrO2/c1-2-3-4-5-6-7-8-9-10-11-12-13(15)14(16)17/h13H,2-12H2,1H3,(H,16,17) |
InChIKey | GBBKJNDQLLKTCX-UHFFFAOYSA-N |
SMILES | CCCCCCCCCCCCC(C(=O)O)Br |