For research use only. Not for therapeutic Use.
2-Butanol-d3 is a high-purity, deuterium-labeled alcohol essential for advanced chemical and biochemical research. This compound, featuring three deuterium atoms, is crucial for studies in metabolic pathways, reaction mechanisms, and chiral analysis. Its stable isotope labeling ensures precise and reliable results in mass spectrometry and NMR spectroscopy. Ideal for cutting-edge research in organic synthesis and analytical chemistry, 2-Butanol-d3 enhances the accuracy of experimental data, supporting advancements in scientific investigations and experimental protocols.
Catalog Number | R043163 |
CAS Number | 53716-61-3 |
Synonyms | sec-Butyl-2’,2’,2’-d3 Alcohol; 2-Butan-1,1,1-d3-ol |
Molecular Formula | C4H10O |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | 1,1,1-trideuteriobutan-2-ol |
InChI | InChI=1S/C4H10O/c1-3-4(2)5/h4-5H,3H2,1-2H3/i2D3 |
InChIKey | BTANRVKWQNVYAZ-BMSJAHLVSA-N |
SMILES | CCC(C)O |