For research use only. Not for therapeutic Use.
2-Butanone Oxime (Cat.No:M144223) is a versatile chemical compound used in industries like adhesives, coatings, and paints. It functions as an anti-skinning agent, preventing the formation of a skin on the surface of coatings. Additionally, it finds applications as a stabilizer for isocyanate-based systems and a blocking agent in organic synthesis.
Catalog Number | M144223 |
CAS Number | 96-29-7 |
Synonyms | 2-BUTANONE OXIME; Ethyl methyl ketoxime; Methyl ethyl ketoxime; 96-29-7; 2-Butanoneoxime; 2-Butanone, oxime |
Molecular Formula | C4H9NO |
Purity | ≥95% |
Storage | -20°C |
InChI | InChI=1S/C4H9NO/c1-3-4(2)5-6/h6H,3H2,1-2H3 |
InChIKey | WHIVNJATOVLWBW-UHFFFAOYSA-N |
SMILES | CCC(=NO)C |