For research use only. Not for therapeutic Use.
2-Butanoylthiophene(Cat No.:I012476), is an organic compound. It belongs to the thiophene family and contains a butanoyl (butyryl) group attached to the thiophene ring. 2-Butanoylthiophene is commonly used as an intermediate in the synthesis of various organic compounds, such as pharmaceuticals, agrochemicals, and fragrances. Its versatile chemical structure makes it valuable in introducing functional groups and building blocks during organic synthesis.
CAS Number | 5333-83-5 |
Synonyms | 2-Butanoylthiophene; AI3-13195; AI3 13195; AI313195;1-(2-Thienyl)butan-1-one |
Molecular Formula | C8H10OS |
Purity | ≥95% |
Solubility | Soluble in DMSO |
Storage | Room Temperature |
IUPAC Name | 1-thiophen-2-ylbutan-1-one |
InChI | InChI=1S/C8H10OS/c1-2-4-7(9)8-5-3-6-10-8/h3,5-6H,2,4H2,1H3 |
InChIKey | YXHIINNJOGKPLF-UHFFFAOYSA-N |
SMILES | CCCC(=O)C1=CC=CS1 |