2-Buten-1-ol, 2-Methyl-, (Z)-（Cat No.:M134098）is an unsaturated alcohol with a hydroxyl group at the 1-position and a double bond in the Z-configuration, accompanied by a methyl group at the 2-position. This compound is commonly utilized in organic synthesis, particularly in the production of fragrances, flavors, and bioactive molecules. Its unique structure allows for selective reactivity, making it a valuable intermediate in the synthesis of complex organic compounds. 2-Buten-1-ol, 2-Methyl-, (Z)- is essential for researchers working on the development of fine chemicals and specialty materials.
| Catalog Number | M134098 |
| CAS Number | 19319-26-7 |
| Synonyms | 2-Buten-1-ol, 2-Methyl-, (Z)- |
| Molecular Formula | C5H10O |
| Purity | 95% |
| Storage | -20°C |
| IUPAC Name | (Z)-2-methylbut-2-en-1-ol |
| InChI | InChI=1S/C5H10O/c1-3-5(2)4-6/h3,6H,4H2,1-2H3/b5-3- |
| InChIKey | NEJDKFPXHQRVMV-HYXAFXHYSA-N |
| SMILES | CC=C(C)CO |
