For research use only. Not for therapeutic Use.
2-Carboxyarabinitol 1-phosphate (Cat No.:M006137) is a naturally occurring metabolic regulator found in plants, playing a crucial role in photosynthesis regulation. Structurally, it closely resembles the sugar phosphates involved in the Calvin cycle, particularly ribulose-1,5-bisphosphate. CA1P acts as an inhibitor of ribulose-1,5-bisphosphate carboxylase/oxygenase (RuBisCO), the enzyme responsible for carbon fixation in photosynthesis. Its function is particularly important during periods of low light or stress when it helps prevent unnecessary RuBisCO activity, thereby conserving energy and resources within the plant. CA1P’s role highlights its potential in studies aimed at improving photosynthetic efficiency and plant stress responses.
CAS Number | 106777-19-9 |
Synonyms | 2-carboxyarabinitol 1-phosphate |
Molecular Formula | C6H13O10P |
Purity | ≥95% |
Storage | Store at RT |
IUPAC Name | (2R,3R,4R)-2,3,4,5-tetrahydroxy-2-(phosphonooxymethyl)pentanoic acid |
InChI | InChI=1S/C6H13O10P/c7-1-3(8)4(9)6(12,5(10)11)2-16-17(13,14)15/h3-4,7-9,12H,1-2H2,(H,10,11)(H2,13,14,15)/t3-,4-,6-/m1/s1 |
InChIKey | UJTMIRNFEXKGMS-ZMIZWQJLSA-N |
SMILES | C(C(C(C(COP(=O)(O)O)(C(=O)O)O)O)O)O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |