Home
>
Chemical Reagents>Heterocyclic Building Blocks> 2-chloro-1-{1H,2H,3H,4H,5H-pyrido[4,3-b]indol-2-yl}
For research use only. Not for therapeutic Use.
2-chloro-1-{1H,2H,3H,4H,5H-pyrido[4,3-b]indol-2-yl}(Cat No.:L007620), is a chemical compound characterized by a pyrido[4,3-b]indol-2-yl group attached to a chlorine atom at the 2-position. This specific molecular structure is significant in medicinal chemistry and drug discovery. Researchers explore its potential biological activities, aiming to understand its role in various physiological processes. Its unique arrangement allows for diverse chemical modifications, making it valuable in the synthesis of novel compounds for biological testing.
Catalog Number | L007620 |
CAS Number | 1087784-16-4 |
Molecular Formula | C13H13ClN2O |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | 2-chloro-1-(1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl)ethanone |
InChI | InChI=1S/C13H13ClN2O/c14-7-13(17)16-6-5-12-10(8-16)9-3-1-2-4-11(9)15-12/h1-4,15H,5-8H2 |
InChIKey | ACUYDSXGSCBUJP-UHFFFAOYSA-N |
SMILES | C1CN(CC2=C1NC3=CC=CC=C23)C(=O)CCl |