2-chloro-1-{1H,2H,3H,4H,5H-pyrido[4,3-b]indol-2-yl}

For research use only. Not for therapeutic Use.

  • CAT Number: L007620
  • CAS Number: 1087784-16-4
  • Molecular Formula: C13H13ClN2O
  • Molecular Weight: 248.71
  • Purity: ≥95%
Inquiry Now

2-chloro-1-{1H,2H,3H,4H,5H-pyrido[4,3-b]indol-2-yl}(Cat No.:L007620), is a chemical compound characterized by a pyrido[4,3-b]indol-2-yl group attached to a chlorine atom at the 2-position. This specific molecular structure is significant in medicinal chemistry and drug discovery. Researchers explore its potential biological activities, aiming to understand its role in various physiological processes. Its unique arrangement allows for diverse chemical modifications, making it valuable in the synthesis of novel compounds for biological testing.


CAS Number 1087784-16-4
Molecular Formula C13H13ClN2O
Purity ≥95%
Storage -20°C
IUPAC Name 2-chloro-1-(1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl)ethanone
InChI InChI=1S/C13H13ClN2O/c14-7-13(17)16-6-5-12-10(8-16)9-3-1-2-4-11(9)15-12/h1-4,15H,5-8H2
InChIKey ACUYDSXGSCBUJP-UHFFFAOYSA-N
SMILES C1CN(CC2=C1NC3=CC=CC=C23)C(=O)CCl
Chemistry Calculators Dilution Calculator
In vivo Formulation Calculator
Molarity Calculator
Molecular Weight Calculator
Reconstitution Calculator

Request a Quote