Home
>
Chemical Reagents>Heterocyclic Building Blocks>
>
2-Chloro-1-(4-hydroxy-2,3-dihydro-1H-isoindol-2-yl)ethan-1-one
For research use only. Not for therapeutic Use.
2-Chloro-1-(4-hydroxy-2,3-dihydro-1H-isoindol-2-yl)ethan-1-one(Cat No.:L007565), is a chemical compound characterized by its molecular structure comprising a chloroacetone group linked to a 4-hydroxy-2,3-dihydro-1H-isoindol-2-yl moiety. This compound is of interest in medicinal chemistry and drug development due to its potential biological activities. Researchers investigate its interactions with biological targets, aiming to understand its role in various physiological processes.
Catalog Number | L007565 |
CAS Number | 2060024-62-4 |
Molecular Formula | C10H10ClNO2 |
Purity | ≥95% |
IUPAC Name | 2-chloro-1-(4-hydroxy-1,3-dihydroisoindol-2-yl)ethanone |
InChI | InChI=1S/C10H10ClNO2/c11-4-10(14)12-5-7-2-1-3-9(13)8(7)6-12/h1-3,13H,4-6H2 |
InChIKey | RWPZUNVIBSGNPV-UHFFFAOYSA-N |
SMILES | C1C2=C(CN1C(=O)CCl)C(=CC=C2)O |