For research use only. Not for therapeutic Use.
2-Chloro-1-buten-3-yne(Cat No.:M084594) is a specialized organic compound that features both alkyne and alkene groups within its structure, making it a reactive molecule suitable for various chemical syntheses. The presence of a chlorine atom adds to its reactivity, allowing for further functionalization. This compound is typically used in the synthesis of more complex organic molecules, serving as a building block in pharmaceuticals, polymers, and other industrial chemicals. Its dual functionality enables it to participate in a wide range of chemical reactions, including coupling reactions and polymerizations, making it valuable in materials science and drug development.
CAS Number | 17712-36-6 |
Synonyms | 2-Chloro-1-buten-3-yne |
Molecular Formula | C4H3Cl |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | 2-chlorobut-1-en-3-yne |
InChI | InChI=1S/C4H3Cl/c1-3-4(2)5/h1H,2H2 |
InChIKey | KRSMTQBJRPTXRB-UHFFFAOYSA-N |
SMILES | C=C(C#C)Cl |