For research use only. Not for therapeutic Use.
2-Chloro-1-pyrazol-1-yl-ethanone (Cat.No:L003624) is a significant chemical compound in organic synthesis. Its unique structure incorporates a pyrazole ring and a chlorine atom, making it a versatile building block in the preparation of various functional molecules. This compound finds applications in medicinal chemistry, agrochemicals, and materials science, highlighting its importance in the development of novel pharmaceuticals and specialized materials for a range of industries.
CAS Number | 28998-74-5 |
Molecular Formula | C5H5ClN2O |
Purity | ≥95% |
IUPAC Name | 2-chloro-1-pyrazol-1-ylethanone |
InChI | InChI=1S/C5H5ClN2O/c6-4-5(9)8-3-1-2-7-8/h1-3H,4H2 |
InChIKey | GQXWKFSCBLCMJX-UHFFFAOYSA-N |
SMILES | C1=CN(N=C1)C(=O)CCl |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |