For research use only. Not for therapeutic Use.
2-Chloro-1,10-phenanthroline(Cat No.:M007509)is a high-purity heterocyclic compound widely used in pharmaceutical, chemical, and coordination chemistry research. Featuring a phenanthroline core with a chlorine substitution at the 2-position, this compound is essential in the synthesis of complex organic molecules, including coordination complexes and catalysts. Its rigid, planar structure allows for strong metal-binding properties, making it valuable in the study of metal-ligand interactions and catalysis. 2-Chloro-1,10-phenanthroline is ideal for precise research applications, contributing to advancements in medicinal and materials chemistry.
CAS Number | 7089-68-1 |
Synonyms | chlorophenanthroline;2-CHLORO-1,10-PHENANTHROLINE;2-Chloro-1,10-diazaphenanthrene;VUF 7730;2-Chloro-1,10-phenan;1,10-Phenanthroline, 2-chloro- |
Molecular Formula | C12H7ClN2 |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | 2-chloro-1,10-phenanthroline |
InChI | InChI=1S/C12H7ClN2/c13-10-6-5-9-4-3-8-2-1-7-14-11(8)12(9)15-10/h1-7H |
InChIKey | JHRMQHFRVPVGHL-UHFFFAOYSA-N |
SMILES | C1=CC2=C(C3=C(C=C2)C=CC(=N3)Cl)N=C1 |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |