For research use only. Not for therapeutic Use.
2-Chloro-1,5-naphthyridine(Cat No.:L035369)is a chemical compound with the molecular formula C8H5ClN2. This compound features a naphthyridine backbone substituted with a chlorine atom at the 2-position. It is primarily used as an intermediate in the synthesis of pharmaceuticals and agrochemicals. Its naphthyridine ring system offers a rigid and electron-deficient platform, making it ideal for nucleophilic substitution reactions and coordination with metal ions in catalysis. This compound’s distinct structure is valuable in the development of drugs targeting DNA replication and cell division, as well as in creating novel organic materials.
CAS Number | 7689-62-5 |
Molecular Formula | C8H5ClN2 |
Purity | ≥95% |
IUPAC Name | 2-chloro-1,5-naphthyridine |
InChI | InChI=1S/C8H5ClN2/c9-8-4-3-6-7(11-8)2-1-5-10-6/h1-5H |
InChIKey | JUYRQGHDOBBUEA-UHFFFAOYSA-N |
SMILES | C1=CC2=C(C=CC(=N2)Cl)N=C1 |