Home
>
Isotope Labeled Compounds>Isotope Labeled Synthetic Intermediates> 2-Chloro-2-methylpropane-d9
For research use only. Not for therapeutic Use.
2-Chloro-2-methylpropane-d9 is a fully deuterated analog of 2-chloro-2-methylpropane, where all nine hydrogen atoms are replaced with deuterium. This isotopically labeled compound is essential in organic chemistry and pharmaceutical research, particularly in the study of reaction mechanisms and kinetic isotope effects. The deuterium labeling enhances the stability of the compound and allows for precise tracking using mass spectrometry and NMR spectroscopy. 2-Chloro-2-methylpropane-d9 is commonly used in research focused on understanding substitution and elimination reactions, providing detailed insights into the behavior of alkyl halides in various chemical processes. Its stability and reliability make it a valuable tool in synthetic chemistry and the development of novel chemical methodologies.
Catalog Number | R016567 |
CAS Number | 918-20-7 |
Synonyms | 1,1-Dimethylethyl-d9 Chloride; 1-Chloro-1,1-dimethylethane-d9; 2-Chloro-2-methylpropane-d9; 2-Chloroisobutane-d9; 2-Methyl-2-chloropropane-d9; 2-Methyl-2-propyl Chloride-d9; Chlorotrimethylmethane-d9; NSC 6527-d9; Trimethylchloromethane-d9; tert-Buty |
Molecular Formula | C4H9Cl |
Purity | ≥95% |
Target | Deuterium (2H, D) |
Storage | Room temperature |
IUPAC Name | 2-chloro-1,1,1,3,3,3-hexadeuterio-2-(trideuteriomethyl)propane |
InChI | InChI=1S/C4H9Cl/c1-4(2,3)5/h1-3H3/i1D3,2D3,3D3 |
InChIKey | NBRKLOOSMBRFMH-GQALSZNTSA-N |
SMILES | [2H]C([2H])([2H])C(C([2H])([2H])[2H])(C([2H])([2H])[2H])Cl |