For research use only. Not for therapeutic Use.
2-Chloro-2′-(trifluoromethyl)biphenyl-3-amine(Cat No.:L024819)is an aromatic compound featuring a biphenyl structure with a chloro group at the 2-position, a trifluoromethyl group at the 2′-position, and an amine group at the 3-position. This compound is widely used in organic synthesis, particularly in the pharmaceutical and agrochemical industries. The combination of chloro and trifluoromethyl groups enhances the compound’s reactivity and stability, making it a valuable intermediate for constructing complex molecular architectures. Its amine functionality allows for further functionalization, contributing to the synthesis of bioactive compounds and advanced materials.
CAS Number | 1261739-69-8 |
Molecular Formula | C13H9ClF3N |
Purity | ≥95% |
IUPAC Name | 2-chloro-3-[2-(trifluoromethyl)phenyl]aniline |
InChI | InChI=1S/C13H9ClF3N/c14-12-9(5-3-7-11(12)18)8-4-1-2-6-10(8)13(15,16)17/h1-7H,18H2 |
InChIKey | MZUSHHVUWWMCIQ-UHFFFAOYSA-N |
SMILES | C1=CC=C(C(=C1)C2=C(C(=CC=C2)N)Cl)C(F)(F)F |