For research use only. Not for therapeutic Use.
2-Chloro-3-fluorobenzaldehyde(CAT: L000022) is a chemical compound with significant applications in organic chemistry. This compound serves as an important intermediate in the synthesis of various organic compounds, enabling the diversification of chemical synthesis. Its specific structure, with both chlorine and fluorine substituents, provides opportunities for creating specialized molecules with potential uses in various areas within the field of organic chemistry.
CAS Number | 96516-31-3 |
Molecular Formula | C7H4ClFO |
Purity | ≥95% |
IUPAC Name | 2-chloro-3-fluorobenzaldehyde |
InChI | InChI=1S/C7H4ClFO/c8-7-5(4-10)2-1-3-6(7)9/h1-4H |
InChIKey | PIZVRLVKXWEMGO-UHFFFAOYSA-N |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |