For research use only. Not for therapeutic Use.
2-Chloro-3-fluoroisonicotinic acid(Cat No.:L024115)is a heterocyclic aromatic compound used in pharmaceutical research and organic synthesis. The molecule features an isonicotinic acid core with chlorine and fluorine atoms substituted at the 2 and 3 positions, respectively. This combination of halogens provides unique reactivity, making it a valuable intermediate in the synthesis of complex molecules, particularly in the development of pharmaceuticals and agrochemicals. The carboxylic acid group allows for versatile chemical modifications, making this compound essential for researchers focused on drug discovery, medicinal chemistry, and the synthesis of advanced therapeutic agents.
CAS Number | 628691-93-0 |
Molecular Formula | C6H3ClFNO2 |
Purity | ≥95% |
IUPAC Name | 2-chloro-3-fluoropyridine-4-carboxylic acid |
InChI | InChI=1S/C6H3ClFNO2/c7-5-4(8)3(6(10)11)1-2-9-5/h1-2H,(H,10,11) |
InChIKey | NWNWBLRKHOVSEL-UHFFFAOYSA-N |
SMILES | C1=CN=C(C(=C1C(=O)O)F)Cl |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |