For research use only. Not for therapeutic Use.
2-chloro-3-(methoxymethoxy)pyridine (Cat.No:L003748) is a notable chemical compound with diverse applications in agrochemical and pharmaceutical research. Its unique structure, featuring a chloropyridine moiety with a methoxymethoxy group, grants it specific reactivity. This compound is employed as a key intermediate in the synthesis of specialized molecules, showcasing its significance in the development of novel pesticides and pharmaceutical agents.
Catalog Number | L003748 |
CAS Number | 862667-72-9 |
Molecular Formula | C7H8ClNO2 |
Purity | ≥95% |
IUPAC Name | 2-chloro-3-(methoxymethoxy)pyridine |
InChI | InChI=1S/C7H8ClNO2/c1-10-5-11-6-3-2-4-9-7(6)8/h2-4H,5H2,1H3 |
InChIKey | KXLDXKULFBUWIT-UHFFFAOYSA-N |
SMILES | COCOC1=C(N=CC=C1)Cl |