For research use only. Not for therapeutic Use.
2-Chloro-3-nitro-5-(trifluoromethyl)benzamide(Cat No.:L006669), is a chemical compound with the molecular formula C8H5ClF3N3O3. It is characterized by a benzene ring substituted with a chlorine atom, a nitro group, and a trifluoromethyl group attached to an amide functional group. This compound’s precise applications can vary, but it is often used in chemical research, particularly in the synthesis of complex molecules and pharmaceuticals. Its specific properties and reactivity make it valuable in organic chemistry, contributing to advancements in drug development and materials science.
CAS Number | 22227-47-0 |
Molecular Formula | C8H4ClF3N2O3 |
Purity | ≥95% |
IUPAC Name | 2-chloro-3-nitro-5-(trifluoromethyl)benzamide |
InChI | InChI=1S/C8H4ClF3N2O3/c9-6-4(7(13)15)1-3(8(10,11)12)2-5(6)14(16)17/h1-2H,(H2,13,15) |
InChIKey | VJMGWMDITIICJK-UHFFFAOYSA-N |
SMILES | C1=C(C=C(C(=C1C(=O)N)Cl)[N+](=O)[O-])C(F)(F)F |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |