For research use only. Not for therapeutic Use.
2-Chloro-3-nitrophenol (Cat No.:M177485) is a chemical compound. It consists of a phenol ring substituted with both a chlorine atom and a nitro group. This compound holds significance in organic synthesis and chemical research for its reactivity and potential applications in various reactions. Its chlorine and nitro substituents provide opportunities for diverse transformations, including nucleophilic substitutions and coupling reactions. 2-Chloro-3-nitrophenol’s role as a versatile reagent and building block contributes to the creation of molecules with specific functionalities for applications in pharmaceuticals, agrochemicals, and materials science, advancing synthetic chemistry and research.
CAS Number | 603-84-9 |
Molecular Formula | C6H4ClNO3 |
Purity | ≥95% |
Storage | Sealed in dry,Room Temperature |
IUPAC Name | 2-chloro-3-nitrophenol |
InChI | InChI=1S/C6H4ClNO3/c7-6-4(8(10)11)2-1-3-5(6)9/h1-3,9H |
InChIKey | QBGLHYQUZJDZOO-UHFFFAOYSA-N |
SMILES | C1=CC(=C(C(=C1)O)Cl)[N+](=O)[O-] |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |