For research use only. Not for therapeutic Use.
2-Chloro-4-(1H-pyrazol-1-yl)benzoic acid(Cat No.:L031992)is a heterocyclic aromatic compound widely utilized in pharmaceutical and organic chemistry. Combining a chloro-substituted benzoic acid with a pyrazole ring, this compound serves as a crucial intermediate in the synthesis of various bioactive molecules, including potential therapeutic agents. Its unique structure makes it particularly valuable in the design of enzyme inhibitors and receptor modulators. Additionally, it is used in developing new chemical entities for drug discovery, facilitating the exploration of novel pharmacological targets and mechanisms.
CAS Number | 313674-12-3 |
Molecular Formula | C10H7ClN2O2 |
Purity | ≥95% |
IUPAC Name | 2-chloro-4-pyrazol-1-ylbenzoic acid |
InChI | InChI=1S/C10H7ClN2O2/c11-9-6-7(13-5-1-4-12-13)2-3-8(9)10(14)15/h1-6H,(H,14,15) |
InChIKey | JBLRHBKKTPDCTI-UHFFFAOYSA-N |
SMILES | C1=CN(N=C1)C2=CC(=C(C=C2)C(=O)O)Cl |