For research use only. Not for therapeutic Use.
2-Chloro-4-(ethanesulfonyl)pyridine(Cat No.:L007811), is a chemical compound with the molecular formula C7H8ClNO2S. This compound features a chloro (Cl) group and an ethanesulfonyl (C2H5SO2) group attached to a pyridine ring. Compounds with similar structures are often employed in organic synthesis and pharmaceutical research. Researchers use them as intermediates in the creation of more complex molecules, particularly in medicinal chemistry. The chloro group and the sulfonyl moiety provide distinctive reactivity to the compound, making it valuable for the development of various compounds for medicinal purposes, including potential pharmaceuticals.
CAS Number | 1697938-44-5 |
Molecular Formula | C7H8ClNO2S |
Purity | ≥95% |
IUPAC Name | 2-chloro-4-ethylsulfonylpyridine |
InChI | InChI=1S/C7H8ClNO2S/c1-2-12(10,11)6-3-4-9-7(8)5-6/h3-5H,2H2,1H3 |
InChIKey | XOHPTAOBQNPWAJ-UHFFFAOYSA-N |
SMILES | CCS(=O)(=O)C1=CC(=NC=C1)Cl |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |