For research use only. Not for therapeutic Use.
2-Chloro-4-fluoro-3-methyl-1-nitrobenzene(Cat No.:L040105)is a high-purity aromatic compound essential for advanced pharmaceutical research and organic synthesis. With chlorine, fluorine, and nitro groups attached to a methyl-substituted benzene ring, this compound is highly reactive, making it a valuable intermediate in the development of complex organic molecules. It is commonly used in the synthesis of pharmaceuticals, agrochemicals, and other bioactive compounds. Its unique structure allows for precise modifications, aiding in the discovery and development of new therapeutic agents. Ideal for medicinal chemistry, this compound ensures reliable and efficient research outcomes.
CAS Number | 90292-62-9 |
Molecular Formula | C7H5ClFNO2 |
Purity | ≥95% |
IUPAC Name | 3-chloro-1-fluoro-2-methyl-4-nitrobenzene |
InChI | InChI=1S/C7H5ClFNO2/c1-4-5(9)2-3-6(7(4)8)10(11)12/h2-3H,1H3 |
InChIKey | OEWOEJIFEWFIGG-UHFFFAOYSA-N |
SMILES | CC1=C(C=CC(=C1Cl)[N+](=O)[O-])F |