For research use only. Not for therapeutic Use.
2′-Chloro-4′-fluoroacetophenone is an aromatic ketone characterized by a chlorine atom at the 2′-position and a fluorine atom at the 4′-position of the acetophenone structure. This compound is significant in organic synthesis and medicinal chemistry due to its potential biological activities, including antimicrobial and anti-inflammatory properties. The presence of halogen substituents enhances its reactivity, allowing for diverse chemical transformations. Its unique structure makes it a valuable intermediate for the development of novel pharmaceuticals and bioactive compounds in drug discovery.
CAS Number | 700-35-6 |
Molecular Formula | C8H6ClFO |
Purity | ≥95% |
IUPAC Name | 1-(2-chloro-4-fluorophenyl)ethanone |
InChI | InChI=1S/C8H6ClFO/c1-5(11)7-3-2-6(10)4-8(7)9/h2-4H,1H3 |
InChIKey | CSEMGLVHVZRXQF-UHFFFAOYSA-N |
SMILES | CC(=O)C1=C(C=C(C=C1)F)Cl |