For research use only. Not for therapeutic Use.
2-Chloro-4-fluorobenzaldehyde(Cat No.:L048322)is a halogenated aromatic compound featuring a chloro and fluoro substituent along with an aldehyde group on a benzene ring. This compound is widely utilized as an intermediate in organic synthesis, particularly in the pharmaceutical and agrochemical industries. Its combination of chlorine and fluorine atoms offers unique reactivity, allowing for selective functionalization in complex molecule development. The aldehyde group further enhances its utility in forming various derivatives, making it an essential building block in the creation of biologically active compounds and advanced materials.
CAS Number | 84194-36-5 |
Molecular Formula | C7H4ClFO |
Purity | ≥95% |
IUPAC Name | 2-chloro-4-fluorobenzaldehyde |
InChI | InChI=1S/C7H4ClFO/c8-7-3-6(9)2-1-5(7)4-10/h1-4H |
InChIKey | KMQWNQKESAHDKD-UHFFFAOYSA-N |
SMILES | C1=CC(=C(C=C1F)Cl)C=O |