For research use only. Not for therapeutic Use.
2-Chloro-4-(fluorosulfonyl)benzoic acid(Cat No.:L007813), is a chemical compound with the molecular formula C7H4ClFO4S. This compound consists of a chloro (Cl) group, a fluorosulfonyl (FSO2) group, and a carboxylic acid (COOH) group attached to a benzene ring. Compounds with similar structures are essential intermediates in the synthesis of various organic compounds, including pharmaceuticals and agrochemicals. The unique combination of functional groups in this compound makes it valuable in the development of specialized materials and chemical research.
CAS Number | 1934852-61-5 |
Molecular Formula | C7H4ClFO4S |
Purity | ≥95% |
IUPAC Name | 2-chloro-4-fluorosulfonylbenzoic acid |
InChI | InChI=1S/C7H4ClFO4S/c8-6-3-4(14(9,12)13)1-2-5(6)7(10)11/h1-3H,(H,10,11) |
InChIKey | BEXNYFYCTVODCD-UHFFFAOYSA-N |
SMILES | C1=CC(=C(C=C1S(=O)(=O)F)Cl)C(=O)O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |