For research use only. Not for therapeutic Use.
2-Chloro-4-iodo-5-methylpyridine is a halogenated pyridine derivative, known for its unique reactivity due to the presence of both chlorine and iodine atoms on the pyridine ring, along with a methyl group. This compound is often used as an intermediate in organic synthesis, particularly in pharmaceutical and agrochemical research. Its halogen atoms provide versatile sites for further functionalization, making it a valuable building block for developing complex molecules and bioactive compounds with potential therapeutic applications.
Catalog Number | M143506 |
CAS Number | 1197957-18-8 |
Synonyms | 2-chloro-4-iodo-5-methylpyridine |
Molecular Formula | C6H5ClIN |
Purity | ≥95% |
Storage | Store at -20 ℃ |
IUPAC Name | 2-chloro-4-iodo-5-methylpyridine |
InChI | InChI=1S/C6H5ClIN/c1-4-3-9-6(7)2-5(4)8/h2-3H,1H3 |
InChIKey | ZWCNVOMJDJPZHE-UHFFFAOYSA-N |
SMILES | CC1=CN=C(C=C1I)Cl |