For research use only. Not for therapeutic Use.
2-Chloro-4-methyl-5,6-dihydro-7H-cyclopenta[b]pyridin-7-one is a chlorinated heterocyclic compound with a fused cyclopentapyridine ring system, used primarily in pharmaceutical and organic synthesis. Its structure, featuring a chlorine atom and a methyl group, provides unique reactivity, making it valuable for developing bioactive molecules, particularly in medicinal chemistry targeting enzyme inhibition and receptor modulation. This compound’s stability and reactive sites enable versatile transformations, supporting applications in drug discovery and the synthesis of complex organic frameworks.
CAS Number | 745075-82-5 |
Molecular Formula | C9H8ClNO |
Purity | ≥95% |
IUPAC Name | 2-chloro-4-methyl-5,6-dihydrocyclopenta[b]pyridin-7-one |
InChI | InChI=1S/C9H8ClNO/c1-5-4-8(10)11-9-6(5)2-3-7(9)12/h4H,2-3H2,1H3 |
InChIKey | BYEKRDZZIDTNLO-UHFFFAOYSA-N |
SMILES | CC1=CC(=NC2=C1CCC2=O)Cl |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |