For research use only. Not for therapeutic Use.
2-Chloro-4-methyl-6-(trifluoromethyl)pyridine（Cat No.:L030163）is a fluorinated heterocyclic compound widely used in pharmaceutical and agrochemical research. Featuring a pyridine ring with chlorine at the 2-position, a methyl group at the 4-position, and a trifluoromethyl group at the 6-position, this compound is a valuable intermediate in the synthesis of bioactive molecules. Its unique combination of substituents provides both stability and reactivity, making it ideal for developing herbicides, insecticides, and therapeutic agents. Its versatility in chemical modifications underscores its importance in advanced organic synthesis and drug discovery.
| Catalog Number | L030163 |
| CAS Number | 749256-90-4 |
| Molecular Formula | C7H5ClF3N |
| Purity | ≥95% |
| IUPAC Name | 2-chloro-4-methyl-6-(trifluoromethyl)pyridine |
| InChI | InChI=1S/C7H5ClF3N/c1-4-2-5(7(9,10)11)12-6(8)3-4/h2-3H,1H3 |
| InChIKey | KAYVWTDOIYYSDL-UHFFFAOYSA-N |
| SMILES | CC1=CC(=NC(=C1)Cl)C(F)(F)F |
