For research use only. Not for therapeutic Use.
2-Chloro-4-methylbenzylamine hydrochloride (Cat.No:L003614) is a significant chemical compound in organic synthesis. Its unique structure incorporates a chloro-substituted benzylamine moiety, imparting specific reactivity and functionality. This compound is employed as a key intermediate in the synthesis of various pharmaceutical agents, highlighting its importance in drug development processes.
| Catalog Number | L003614 |
| CAS Number | 202522-25-6 |
| Molecular Formula | C8H11Cl2N |
| Purity | ≥95% |
| IUPAC Name | (2-chloro-4-methylphenyl)methanamine;hydrochloride |
| InChI | InChI=1S/C8H10ClN.ClH/c1-6-2-3-7(5-10)8(9)4-6;/h2-4H,5,10H2,1H3;1H |
| InChIKey | KYDVWBXNJYMHNT-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1)CN)Cl.Cl |
